3-methylnona-2,4,6-triene-2-sulfonic acid

C10H16O3S — CID 74010619

IUPAC3-methylnona-2,4,6-triene-2-sulfonic acid
SMILESCCC=CC=CC(C)=C(C)S(=O)(=O)O
InChIInChI=1S/C10H16O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h5-8H,4H2,1-3H3,(H,11,12,13)
InChIKeyCSCHGYFHAQMYBK-UHFFFAOYSA-N
MW216.30 g/mol
LogP2.69
Rot. Bonds4

About 3-methylnona-2,4,6-triene-2-sulfonic acid

3-methylnona-2,4,6-triene-2-sulfonic acid (PubChem CID 74010619) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 3-methylnona-2,4,6-triene-2-sulfonic acid.

Molecular Properties

Compound Name3-methylnona-2,4,6-triene-2-sulfonic acid
PubChem CID74010619
Molecular FormulaC10H16O3S
Molecular Weight216.30 g/mol
Exact Mass216.08
IUPAC Name3-methylnona-2,4,6-triene-2-sulfonic acid
SMILESCCC=CC=CC(C)=C(C)S(=O)(=O)O
InChIInChI=1S/C10H16O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h5-8H,4H2,1-3H3,(H,11,12,13)
InChIKeyCSCHGYFHAQMYBK-UHFFFAOYSA-N
XLogP2.69
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.30
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-methylnona-2,4,6-triene-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylnona-2,4,6-triene-2-sulfonic acid?
The IUPAC name of 3-methylnona-2,4,6-triene-2-sulfonic acid (CID 74010619) is 3-methylnona-2,4,6-triene-2-sulfonic acid.
What is the SMILES notation for 3-methylnona-2,4,6-triene-2-sulfonic acid?
The canonical SMILES for 3-methylnona-2,4,6-triene-2-sulfonic acid is CCC=CC=CC(C)=C(C)S(=O)(=O)O.
What is the InChIKey of 3-methylnona-2,4,6-triene-2-sulfonic acid?
The InChIKey is CSCHGYFHAQMYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h5-8H,4H2,1-3H3,(H,11,12,13).
What are the key properties of 3-methylnona-2,4,6-triene-2-sulfonic acid?
3-methylnona-2,4,6-triene-2-sulfonic acid has a molecular weight of 216.30 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylnona-2,4,6-triene-2-sulfonic acid is sourced from PubChem (CID 74010619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).