C9H11FO2 — CID 74010930
7-fluoro-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 74010930) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 7-fluoro-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-fluoro-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 74010930 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 7-fluoro-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C=COC2CC(F)CCC12 |
| InChI | InChI=1S/C9H11FO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h3-4,6-7,9H,1-2,5H2 |
| InChIKey | ILMUAXKMLDUXRP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |