About 4-fluorophenol;zirconium
4-fluorophenol;zirconium (PubChem CID 74015831) has the molecular formula C6H5FOZr
and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-fluorophenol;zirconium.
Molecular Properties
| Compound Name | 4-fluorophenol;zirconium |
| PubChem CID | 74015831 |
| Molecular Formula | C6H5FOZr |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | 4-fluorophenol;zirconium |
| SMILES | Oc1ccc(F)cc1.[Zr] |
| InChI | InChI=1S/C6H5FO.Zr/c7-5-1-3-6(8)4-2-5;/h1-4,8H; |
| InChIKey | GBXGJZJZBMLLHD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluorophenol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophenol;zirconium?
The IUPAC name of 4-fluorophenol;zirconium (CID 74015831) is 4-fluorophenol;zirconium.
What is the SMILES notation for 4-fluorophenol;zirconium?
The canonical SMILES for 4-fluorophenol;zirconium is Oc1ccc(F)cc1.[Zr].
What is the InChIKey of 4-fluorophenol;zirconium?
The InChIKey is GBXGJZJZBMLLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.Zr/c7-5-1-3-6(8)4-2-5;/h1-4,8H;.
What are the key properties of 4-fluorophenol;zirconium?
4-fluorophenol;zirconium has a molecular weight of 203.33 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;zirconium is sourced from PubChem (CID 74015831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).