About 1-acetyloxypent-2-enyl acetate
1-acetyloxypent-2-enyl acetate (PubChem CID 74016470) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-acetyloxypent-2-enyl acetate.
Molecular Properties
| Compound Name | 1-acetyloxypent-2-enyl acetate |
| PubChem CID | 74016470 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-acetyloxypent-2-enyl acetate |
| SMILES | CCC=CC(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C9H14O4/c1-4-5-6-9(12-7(2)10)13-8(3)11/h5-6,9H,4H2,1-3H3 |
| InChIKey | OJGOLJMFDQVUHX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyloxypent-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyloxypent-2-enyl acetate?
The IUPAC name of 1-acetyloxypent-2-enyl acetate (CID 74016470) is 1-acetyloxypent-2-enyl acetate.
What is the SMILES notation for 1-acetyloxypent-2-enyl acetate?
The canonical SMILES for 1-acetyloxypent-2-enyl acetate is CCC=CC(OC(C)=O)OC(C)=O.
What is the InChIKey of 1-acetyloxypent-2-enyl acetate?
The InChIKey is OJGOLJMFDQVUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-4-5-6-9(12-7(2)10)13-8(3)11/h5-6,9H,4H2,1-3H3.
What are the key properties of 1-acetyloxypent-2-enyl acetate?
1-acetyloxypent-2-enyl acetate has a molecular weight of 186.21 g/mol, XLogP of 1.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyloxypent-2-enyl acetate is sourced from PubChem (CID 74016470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).