About 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane
18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane (PubChem CID 74017988) has the molecular formula C17H29N2+
and a molecular weight of 261.43 g/mol. Its IUPAC name is 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane.
Molecular Properties
| Compound Name | 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane |
| PubChem CID | 74017988 |
| Molecular Formula | C17H29N2+ |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane |
| SMILES | C1CC2CCC3CC4CCC5CCCC(C(C1)N23)[NH+]54 |
| InChI | InChI=1S/C17H28N2/c1-3-12-7-9-14-11-15-10-8-13-4-2-6-17(19(13)15)16(5-1)18(12)14/h12-17H,1-11H2/p+1 |
| InChIKey | CDKSMRJPWIZZPN-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane?
The IUPAC name of 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane (CID 74017988) is 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane.
What is the SMILES notation for 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane?
The canonical SMILES for 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane is C1CC2CCC3CC4CCC5CCCC(C(C1)N23)[NH+]54.
What is the InChIKey of 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane?
The InChIKey is CDKSMRJPWIZZPN-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H28N2/c1-3-12-7-9-14-11-15-10-8-13-4-2-6-17(19(13)15)16(5-1)18(12)14/h12-17H,1-11H2/p+1.
What are the key properties of 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane?
18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane has a molecular weight of 261.43 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane is sourced from PubChem (CID 74017988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).