C21H20FN2O4+ — CID 7401897
methyl (1R,3S,3aS,6aS)-1-(4-fluorophenyl)-3-methyl-4,6-dioxo-5-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 7401897) has the molecular formula C21H20FN2O4+ and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl (1R,3S,3aS,6aS)-1-(4-fluorophenyl)-3-methyl-4,6-dioxo-5-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | methyl (1R,3S,3aS,6aS)-1-(4-fluorophenyl)-3-methyl-4,6-dioxo-5-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7401897 |
| Molecular Formula | C21H20FN2O4+ |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | methyl (1R,3S,3aS,6aS)-1-(4-fluorophenyl)-3-methyl-4,6-dioxo-5-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[NH2+][C@@H](c2ccc(F)cc2)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H19FN2O4/c1-21(20(27)28-2)16-15(17(23-21)12-8-10-13(22)11-9-12)18(25)24(19(16)26)14-6-4-3-5-7-14/h3-11,15-17,23H,1-2H3/p+1/t15-,16+,17-,21-/m0/s1 |
| InChIKey | MMTCGVFQEZEANG-DLRJPAPCSA-O |
| XLogP | 1.18 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|