C19H19N3O6S — CID 7401931
[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 7401931) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7401931 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@@H]1CCc2sc(C(=O)OCC(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)cc2C1 |
| InChI | InChI=1S/C19H19N3O6S/c1-11-2-7-15-13(8-11)9-16(29-15)19(25)28-10-17(23)20-21-18(24)12-3-5-14(6-4-12)22(26)27/h3-6,9,11H,2,7-8,10H2,1H3,(H,20,23)(H,21,24)/t11-/m1/s1 |
| InChIKey | ZWPSZVPWJDUELT-LLVKDONJSA-N |
| XLogP | 2.40 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|