About ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate
ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 74019557) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 74019557 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCC=CC=CC1C(C(=O)OCC)C1(C)C |
| InChI | InChI=1S/C14H22O2/c1-5-7-8-9-10-11-12(14(11,3)4)13(15)16-6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | YRROPTBXUZTINE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate (CID 74019557) is ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate is CCC=CC=CC1C(C(=O)OCC)C1(C)C.
What is the InChIKey of ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is YRROPTBXUZTINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-5-7-8-9-10-11-12(14(11,3)4)13(15)16-6-2/h7-12H,5-6H2,1-4H3.
What are the key properties of ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate?
ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 222.33 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hexa-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 74019557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).