About 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione
5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione (PubChem CID 74020651) has the molecular formula C8H4O3S
and a molecular weight of 180.18 g/mol. Its IUPAC name is 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione.
Molecular Properties
| Compound Name | 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione |
| PubChem CID | 74020651 |
| Molecular Formula | C8H4O3S |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 179.99 |
| IUPAC Name | 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione |
| SMILES | O=C1C(=CO)C(=O)c2sccc21 |
| InChI | InChI=1S/C8H4O3S/c9-3-5-6(10)4-1-2-12-8(4)7(5)11/h1-3,9H |
| InChIKey | GQGVYNAABXHKTD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione?
The IUPAC name of 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione (CID 74020651) is 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione.
What is the SMILES notation for 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione?
The canonical SMILES for 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione is O=C1C(=CO)C(=O)c2sccc21.
What is the InChIKey of 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione?
The InChIKey is GQGVYNAABXHKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3S/c9-3-5-6(10)4-1-2-12-8(4)7(5)11/h1-3,9H.
What are the key properties of 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione?
5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione has a molecular weight of 180.18 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethylidene)cyclopenta[b]thiophene-4,6-dione is sourced from PubChem (CID 74020651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).