C35H46O11 — CID 74020939
[9,17-diacetyloxy-8-(furan-3-yl)-12-hydroxy-1,9,11,16-tetramethyl-5,14,21-trioxahexacyclo[11.6.1.14,10.02,11.06,10.016,20]henicosan-19-yl] 2-methylbut-2-enoate (PubChem CID 74020939) has the molecular formula C35H46O11 and a molecular weight of 642.74 g/mol. Its IUPAC name is [9,17-diacetyloxy-8-(furan-3-yl)-12-hydroxy-1,9,11,16-tetramethyl-5,14,21-trioxahexacyclo[11.6.1.14,10.02,11.06,10.016,20]henicosan-19-yl] 2-methylbut-2-enoate.
| Compound Name | [9,17-diacetyloxy-8-(furan-3-yl)-12-hydroxy-1,9,11,16-tetramethyl-5,14,21-trioxahexacyclo[11.6.1.14,10.02,11.06,10.016,20]henicosan-19-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 74020939 |
| Molecular Formula | C35H46O11 |
| Molecular Weight | 642.74 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | [9,17-diacetyloxy-8-(furan-3-yl)-12-hydroxy-1,9,11,16-tetramethyl-5,14,21-trioxahexacyclo[11.6.1.14,10.02,11.06,10.016,20]henicosan-19-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CC(OC(C)=O)C2(C)COC3C2C1(C)C1CC2OC4CC(c5ccoc5)C(C)(OC(C)=O)C4(O2)C1(C)C3O |
| InChI | InChI=1S/C35H46O11/c1-9-17(2)30(39)44-24-14-23(42-18(3)36)31(5)16-41-27-28(31)32(24,6)22-13-26-43-25-12-21(20-10-11-40-15-20)34(8,45-19(4)37)35(25,46-26)33(22,7)29(27)38/h9-11,15,21-29,38H,12-14,16H2,1-8H3 |
| InChIKey | AKWPIYLLGRJFDT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|