About 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal
3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal (PubChem CID 74020965) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal.
Molecular Properties
| Compound Name | 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal |
| PubChem CID | 74020965 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal |
| SMILES | CC1(CCC=O)C2CC3C(C2)C31C |
| InChI | InChI=1S/C12H18O/c1-11(4-3-5-13)8-6-9-10(7-8)12(9,11)2/h5,8-10H,3-4,6-7H2,1-2H3 |
| InChIKey | GBXFUOBZYUTFOP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal?
The IUPAC name of 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal (CID 74020965) is 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal.
What is the SMILES notation for 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal?
The canonical SMILES for 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal is CC1(CCC=O)C2CC3C(C2)C31C.
What is the InChIKey of 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal?
The InChIKey is GBXFUOBZYUTFOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-11(4-3-5-13)8-6-9-10(7-8)12(9,11)2/h5,8-10H,3-4,6-7H2,1-2H3.
What are the key properties of 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal?
3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal has a molecular weight of 178.27 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanal is sourced from PubChem (CID 74020965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).