C14H16O6 — CID 74021108
(1,11-dimethyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecan-5-ylidene)methyl acetate (PubChem CID 74021108) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1,11-dimethyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecan-5-ylidene)methyl acetate.
| Compound Name | (1,11-dimethyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecan-5-ylidene)methyl acetate |
|---|---|
| PubChem CID | 74021108 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1,11-dimethyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecan-5-ylidene)methyl acetate |
| SMILES | CC(=O)OC=C1C2C3OC4OC5(C)OC(C)(O3)C2C5C14 |
| InChI | InChI=1S/C14H16O6/c1-5(15)16-4-6-7-9-10-8(6)12-17-11(7)18-13(9,2)20-14(10,3)19-12/h4,7-12H,1-3H3 |
| InChIKey | YGKPFQZDTZOLPK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|