About 1,2-diethyl-4,5-dimethylcyclohexene
1,2-diethyl-4,5-dimethylcyclohexene (PubChem CID 74022411) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 1,2-diethyl-4,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1,2-diethyl-4,5-dimethylcyclohexene |
| PubChem CID | 74022411 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 1,2-diethyl-4,5-dimethylcyclohexene |
| SMILES | CCC1=C(CC)CC(C)C(C)C1 |
| InChI | InChI=1S/C12H22/c1-5-11-7-9(3)10(4)8-12(11)6-2/h9-10H,5-8H2,1-4H3 |
| InChIKey | XUMONOAZCBOGJX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethyl-4,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-4,5-dimethylcyclohexene?
The IUPAC name of 1,2-diethyl-4,5-dimethylcyclohexene (CID 74022411) is 1,2-diethyl-4,5-dimethylcyclohexene.
What is the SMILES notation for 1,2-diethyl-4,5-dimethylcyclohexene?
The canonical SMILES for 1,2-diethyl-4,5-dimethylcyclohexene is CCC1=C(CC)CC(C)C(C)C1.
What is the InChIKey of 1,2-diethyl-4,5-dimethylcyclohexene?
The InChIKey is XUMONOAZCBOGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-5-11-7-9(3)10(4)8-12(11)6-2/h9-10H,5-8H2,1-4H3.
What are the key properties of 1,2-diethyl-4,5-dimethylcyclohexene?
1,2-diethyl-4,5-dimethylcyclohexene has a molecular weight of 166.31 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-4,5-dimethylcyclohexene is sourced from PubChem (CID 74022411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).