C25H36O8 — CID 74022489
dimethyl 7-butyl-3-ethoxy-4,11,18-trioxahexacyclo[10.4.2.01,5.05,12.06,15.08,13]octadecane-14,15-dicarboxylate (PubChem CID 74022489) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is dimethyl 7-butyl-3-ethoxy-4,11,18-trioxahexacyclo[10.4.2.01,5.05,12.06,15.08,13]octadecane-14,15-dicarboxylate.
| Compound Name | dimethyl 7-butyl-3-ethoxy-4,11,18-trioxahexacyclo[10.4.2.01,5.05,12.06,15.08,13]octadecane-14,15-dicarboxylate |
|---|---|
| PubChem CID | 74022489 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | dimethyl 7-butyl-3-ethoxy-4,11,18-trioxahexacyclo[10.4.2.01,5.05,12.06,15.08,13]octadecane-14,15-dicarboxylate |
| SMILES | CCCCC1C2CCOC34OCC56CC(OCC)OC53C1C(C(=O)OC)(C6)C(C(=O)OC)C24 |
| InChI | InChI=1S/C25H36O8/c1-5-7-8-15-14-9-10-31-25-17(14)18(20(26)28-3)23(21(27)29-4)12-22(13-32-25)11-16(30-6-2)33-24(22,25)19(15)23/h14-19H,5-13H2,1-4H3 |
| InChIKey | NGKOPKMGVIHIQO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |