About 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane
2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane (PubChem CID 74023411) has the molecular formula C7H8F6
and a molecular weight of 206.13 g/mol. Its IUPAC name is 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane.
Molecular Properties
| Compound Name | 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane |
| PubChem CID | 74023411 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane |
| SMILES | CC1C(C)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6/c1-3-4(2)5(3,6(8,9)10)7(11,12)13/h3-4H,1-2H3 |
| InChIKey | POMUTXRKAJVZJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane?
The IUPAC name of 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane (CID 74023411) is 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane.
What is the SMILES notation for 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane?
The canonical SMILES for 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane is CC1C(C)C1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane?
The InChIKey is POMUTXRKAJVZJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F6/c1-3-4(2)5(3,6(8,9)10)7(11,12)13/h3-4H,1-2H3.
What are the key properties of 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane?
2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane has a molecular weight of 206.13 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,1-bis(trifluoromethyl)cyclopropane is sourced from PubChem (CID 74023411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).