C10H17F2N — CID 74024032
6,6-difluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-2-amine (PubChem CID 74024032) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 6,6-difluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-2-amine.
| Compound Name | 6,6-difluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 74024032 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 6,6-difluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-2-amine |
| SMILES | NC1CCC2CC(F)(F)CCC2C1 |
| InChI | InChI=1S/C10H17F2N/c11-10(12)4-3-7-5-9(13)2-1-8(7)6-10/h7-9H,1-6,13H2 |
| InChIKey | OQTVWMWDIUGGKF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |