C20H32O4S2 — CID 74027758
4-[3,3-bis(ethylsulfanyl)-1-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 74027758) has the molecular formula C20H32O4S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[3,3-bis(ethylsulfanyl)-1-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[3,3-bis(ethylsulfanyl)-1-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 74027758 |
| Molecular Formula | C20H32O4S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[3,3-bis(ethylsulfanyl)-1-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCSC(CC(OCc1ccc(OC)cc1)C1COC(C)(C)O1)SCC |
| InChI | InChI=1S/C20H32O4S2/c1-6-25-19(26-7-2)12-17(18-14-23-20(3,4)24-18)22-13-15-8-10-16(21-5)11-9-15/h8-11,17-19H,6-7,12-14H2,1-5H3 |
| InChIKey | HCYZABKCQIDRFA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|