C22H30O5 — CID 74028384
(4-acetyl-7,11-dimethyl-16-methylidene-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl) acetate (PubChem CID 74028384) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4-acetyl-7,11-dimethyl-16-methylidene-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl) acetate.
| Compound Name | (4-acetyl-7,11-dimethyl-16-methylidene-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl) acetate |
|---|---|
| PubChem CID | 74028384 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4-acetyl-7,11-dimethyl-16-methylidene-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl) acetate |
| SMILES | C=C1C(=O)OC2C=C(C)CCC=C(C)CCC(C(C)=O)C(OC(C)=O)CC12 |
| InChI | InChI=1S/C22H30O5/c1-13-7-6-8-14(2)11-20-19(15(3)22(25)27-20)12-21(26-17(5)24)18(10-9-13)16(4)23/h7,11,18-21H,3,6,8-10,12H2,1-2,4-5H3 |
| InChIKey | POKKLMMGTSYIOG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|