C19H16N2O2S2 — CID 7402900
ethyl 5-amino-4-cyano-3-(naphthalen-2-ylsulfanylmethyl)thiophene-2-carboxylate (PubChem CID 7402900) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-(naphthalen-2-ylsulfanylmethyl)thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-(naphthalen-2-ylsulfanylmethyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7402900 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-(naphthalen-2-ylsulfanylmethyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16N2O2S2/c1-2-23-19(22)17-16(15(10-20)18(21)25-17)11-24-14-8-7-12-5-3-4-6-13(12)9-14/h3-9H,2,11,21H2,1H3 |
| InChIKey | ZTMCASHDMTWGPB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |