C34H40O21 — CID 74029808
[2,4,5-triacetyloxy-6-[(4-ethenyl-4a-hydroxy-8-oxo-3,4,5,6-tetrahydropyrano[3,4-c]pyran-3-yl)oxy]oxan-3-yl] 2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate (PubChem CID 74029808) has the molecular formula C34H40O21 and a molecular weight of 784.67 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-6-[(4-ethenyl-4a-hydroxy-8-oxo-3,4,5,6-tetrahydropyrano[3,4-c]pyran-3-yl)oxy]oxan-3-yl] 2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate.
| Compound Name | [2,4,5-triacetyloxy-6-[(4-ethenyl-4a-hydroxy-8-oxo-3,4,5,6-tetrahydropyrano[3,4-c]pyran-3-yl)oxy]oxan-3-yl] 2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 74029808 |
| Molecular Formula | C34H40O21 |
| Molecular Weight | 784.67 g/mol |
| Exact Mass | 784.21 |
| IUPAC Name | [2,4,5-triacetyloxy-6-[(4-ethenyl-4a-hydroxy-8-oxo-3,4,5,6-tetrahydropyrano[3,4-c]pyran-3-yl)oxy]oxan-3-yl] 2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| SMILES | C=CC1C(OC2OC(OC(C)=O)C(OC(=O)c3cccc(OC4OC(CO)C(O)C(O)C4O)c3O)C(OC(C)=O)C2OC(C)=O)OC=C2C(=O)OCCC21O |
| InChI | InChI=1S/C34H40O21/c1-5-17-30(47-12-18-29(44)46-10-9-34(17,18)45)54-33-26(49-14(3)37)25(48-13(2)36)27(32(55-33)50-15(4)38)53-28(43)16-7-6-8-19(21(16)39)51-31-24(42)23(41)22(40)20(11-35)52-31/h5-8,12,17,20,22-27,30-33,35,39-42,45H,1,9-11H2,2-4H3 |
| InChIKey | RSNVTHNELSWVLS-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 299.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.67 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|