About N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide
N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide (PubChem CID 74031936) has the molecular formula C26H21N8+
and a molecular weight of 445.51 g/mol. Its IUPAC name is N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide.
Molecular Properties
| Compound Name | N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide |
| PubChem CID | 74031936 |
| Molecular Formula | C26H21N8+ |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide |
| SMILES | c1ccc(/N=N/C(=NNc2ccccc2)c2nn(-c3ccccc3)n[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N8/c1-5-13-21(14-6-1)27-29-25(30-28-22-15-7-2-8-16-22)26-31-34(24-19-11-4-12-20-24)32-33(26)23-17-9-3-10-18-23/h1-20,27H/q+1/b29-25?,30-28+ |
| InChIKey | XZWQFJBTQPHIFI-ZJPOQKLXSA-N |
| XLogP | 5.10 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide?
The IUPAC name of N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide (CID 74031936) is N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide.
What is the SMILES notation for N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide?
The canonical SMILES for N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide is c1ccc(/N=N/C(=NNc2ccccc2)c2nn(-c3ccccc3)n[n+]2-c2ccccc2)cc1.
What is the InChIKey of N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide?
The InChIKey is XZWQFJBTQPHIFI-ZJPOQKLXSA-N. The full InChI is InChI=1S/C26H21N8/c1-5-13-21(14-6-1)27-29-25(30-28-22-15-7-2-8-16-22)26-31-34(24-19-11-4-12-20-24)32-33(26)23-17-9-3-10-18-23/h1-20,27H/q+1/b29-25?,30-28+.
What are the key properties of N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide?
N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide has a molecular weight of 445.51 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-anilino-1,3-diphenyl-N-phenyliminotetrazol-1-ium-5-carboximidamide is sourced from PubChem (CID 74031936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).