About prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate
prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate (PubChem CID 74032402) has the molecular formula C9H11N3O3S
and a molecular weight of 241.27 g/mol. Its IUPAC name is prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 74032402 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1cnc(CNC=O)s1 |
| InChI | InChI=1S/C9H11N3O3S/c1-2-3-15-9(14)12-8-5-11-7(16-8)4-10-6-13/h2,5-6H,1,3-4H2,(H,10,13)(H,12,14) |
| InChIKey | GSVWYDPDJMOSJN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate?
The IUPAC name of prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate (CID 74032402) is prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate is C=CCOC(=O)Nc1cnc(CNC=O)s1.
What is the InChIKey of prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate?
The InChIKey is GSVWYDPDJMOSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3S/c1-2-3-15-9(14)12-8-5-11-7(16-8)4-10-6-13/h2,5-6H,1,3-4H2,(H,10,13)(H,12,14).
What are the key properties of prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate?
prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate has a molecular weight of 241.27 g/mol, XLogP of 1.12, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-[2-(formamidomethyl)-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 74032402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).