About 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine
2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine (PubChem CID 74033311) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine |
| PubChem CID | 74033311 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine |
| SMILES | C#CC=CSCCN(CC)CC |
| InChI | InChI=1S/C10H17NS/c1-4-7-9-12-10-8-11(5-2)6-3/h1,7,9H,5-6,8,10H2,2-3H3 |
| InChIKey | CHOOHVCUHACOQK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine?
The IUPAC name of 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine (CID 74033311) is 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine.
What is the SMILES notation for 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine?
The canonical SMILES for 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine is C#CC=CSCCN(CC)CC.
What is the InChIKey of 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine?
The InChIKey is CHOOHVCUHACOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-4-7-9-12-10-8-11(5-2)6-3/h1,7,9H,5-6,8,10H2,2-3H3.
What are the key properties of 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine?
2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine has a molecular weight of 183.32 g/mol, XLogP of 2.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-en-3-ynylsulfanyl-N,N-diethylethanamine is sourced from PubChem (CID 74033311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).