About 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal
5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal (PubChem CID 74036488) has the molecular formula C21H24O
and a molecular weight of 292.42 g/mol. Its IUPAC name is 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal.
Molecular Properties
| Compound Name | 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal |
| PubChem CID | 74036488 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal |
| SMILES | CC(C=Cc1cc(C)c2cc(C(C)C)ccc(C)c1-2)=CC=O |
| InChI | InChI=1S/C21H24O/c1-14(2)18-9-7-16(4)21-19(8-6-15(3)10-11-22)12-17(5)20(21)13-18/h6-14H,1-5H3 |
| InChIKey | AETKBNBENHOMFZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal?
The IUPAC name of 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal (CID 74036488) is 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal.
What is the SMILES notation for 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal?
The canonical SMILES for 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal is CC(C=Cc1cc(C)c2cc(C(C)C)ccc(C)c1-2)=CC=O.
What is the InChIKey of 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal?
The InChIKey is AETKBNBENHOMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O/c1-14(2)18-9-7-16(4)21-19(8-6-15(3)10-11-22)12-17(5)20(21)13-18/h6-14H,1-5H3.
What are the key properties of 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal?
5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal has a molecular weight of 292.42 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal is sourced from PubChem (CID 74036488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).