C20H21N3OS — CID 7403971
(2Z,5R)-5-methyl-3-[(2-methylphenyl)methyl]-2-[(Z)-(4-methylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 7403971) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is (2Z,5R)-5-methyl-3-[(2-methylphenyl)methyl]-2-[(Z)-(4-methylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-5-methyl-3-[(2-methylphenyl)methyl]-2-[(Z)-(4-methylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7403971 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2Z,5R)-5-methyl-3-[(2-methylphenyl)methyl]-2-[(Z)-(4-methylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/C=N\N=C2/S[C@H](C)C(=O)N2Cc2ccccc2C)cc1 |
| InChI | InChI=1S/C20H21N3OS/c1-14-8-10-17(11-9-14)12-21-22-20-23(19(24)16(3)25-20)13-18-7-5-4-6-15(18)2/h4-12,16H,13H2,1-3H3/b21-12-,22-20-/t16-/m1/s1 |
| InChIKey | YZHIHNNYLIGCBH-DRTMTEDASA-N |
| XLogP | 4.16 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|