C13H14N2O2 — CID 74041276
1,3-dimethyl-5-(3-oxobut-1-enyl)benzimidazol-2-one (PubChem CID 74041276) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-oxobut-1-enyl)benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-(3-oxobut-1-enyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 74041276 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,3-dimethyl-5-(3-oxobut-1-enyl)benzimidazol-2-one |
| SMILES | CC(=O)C=Cc1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H14N2O2/c1-9(16)4-5-10-6-7-11-12(8-10)15(3)13(17)14(11)2/h4-8H,1-3H3 |
| InChIKey | BBVXFPBSOIWZHM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|