C18H23FN2O2 — CID 74042000
2-(2-fluorophenoxy)-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide (PubChem CID 74042000) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
|---|---|
| PubChem CID | 74042000 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
| SMILES | CC12CCC(CC1=NNC(=O)COc1ccccc1F)C2(C)C |
| InChI | InChI=1S/C18H23FN2O2/c1-17(2)12-8-9-18(17,3)15(10-12)20-21-16(22)11-23-14-7-5-4-6-13(14)19/h4-7,12H,8-11H2,1-3H3,(H,21,22) |
| InChIKey | NBVOXDBMVHUMFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|