C17H16O5 — CID 740422
2-(4,4-dimethyl-2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione (PubChem CID 740422) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione.
| Compound Name | 2-(4,4-dimethyl-2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 740422 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(4,4-dimethyl-2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C2(O)C(=O)c3ccccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C17H16O5/c1-16(2)7-11(18)13(12(19)8-16)17(22)14(20)9-5-3-4-6-10(9)15(17)21/h3-6,13,22H,7-8H2,1-2H3 |
| InChIKey | XAXPKPCIXYIRIU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|