C38H29ClO6 — CID 74042276
4-[4-(2,6-diphenylpyran-4-ylidene)but-2-en-2-yl]-2,6-diphenylpyrylium perchlorate (PubChem CID 74042276) has the molecular formula C38H29ClO6 and a molecular weight of 617.10 g/mol. Its IUPAC name is 4-[4-(2,6-diphenylpyran-4-ylidene)but-2-en-2-yl]-2,6-diphenylpyrylium perchlorate.
| Compound Name | 4-[4-(2,6-diphenylpyran-4-ylidene)but-2-en-2-yl]-2,6-diphenylpyrylium perchlorate |
|---|---|
| PubChem CID | 74042276 |
| Molecular Formula | C38H29ClO6 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | 4-[4-(2,6-diphenylpyran-4-ylidene)but-2-en-2-yl]-2,6-diphenylpyrylium perchlorate |
| SMILES | CC(=CC=C1C=C(c2ccccc2)OC(c2ccccc2)=C1)c1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C38H29O2.ClHO4/c1-28(34-26-37(32-18-10-4-11-19-32)40-38(27-34)33-20-12-5-13-21-33)22-23-29-24-35(30-14-6-2-7-15-30)39-36(25-29)31-16-8-3-9-17-31;2-1(3,4)5/h2-27H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DIAABJHPLDRSBD-UHFFFAOYSA-M |
| XLogP | 5.58 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|