C18H28N2O — CID 74044271
N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethylidene]hydroxylamine (PubChem CID 74044271) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 74044271 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethylidene]hydroxylamine |
| SMILES | CCCN(CCC)C1CCc2cccc(C(C)=NO)c2C1 |
| InChI | InChI=1S/C18H28N2O/c1-4-11-20(12-5-2)16-10-9-15-7-6-8-17(14(3)19-21)18(15)13-16/h6-8,16,21H,4-5,9-13H2,1-3H3 |
| InChIKey | CZDXNRNTDRQHLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|