C20H18FN7O2 — CID 74045938
N'-[4-amino-1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 74045938) has the molecular formula C20H18FN7O2 and a molecular weight of 407.41 g/mol. Its IUPAC name is N'-[4-amino-1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-amino-1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 74045938 |
| Molecular Formula | C20H18FN7O2 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N'-[4-amino-1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc(N)c2c(-c3ccc(C=O)o3)nn(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C20H18FN7O2/c1-27(2)11-23-20-24-18(22)16-17(15-8-7-13(10-29)30-15)26-28(19(16)25-20)9-12-5-3-4-6-14(12)21/h3-8,10-11H,9H2,1-2H3,(H2,22,24,25) |
| InChIKey | MZRNGTQDJKXHEY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|