C16H18ClNO — CID 7404844
(E)-N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 7404844) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is (E)-N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7404844 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (E)-N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H18ClNO/c17-14-6-2-11(3-7-14)4-8-16(19)18-15-10-12-1-5-13(15)9-12/h2-4,6-8,12-13,15H,1,5,9-10H2,(H,18,19)/b8-4+/t12-,13-,15+/m0/s1 |
| InChIKey | IZDKSFJXJNRJJR-DZHMOHBCSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|