C8H12N4O3 — CID 74050912
6,8-dimethyl-4a,5,6,8a-tetrahydro-1H-pteridine-2,4,7-trione (PubChem CID 74050912) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 6,8-dimethyl-4a,5,6,8a-tetrahydro-1H-pteridine-2,4,7-trione.
| Compound Name | 6,8-dimethyl-4a,5,6,8a-tetrahydro-1H-pteridine-2,4,7-trione |
|---|---|
| PubChem CID | 74050912 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 6,8-dimethyl-4a,5,6,8a-tetrahydro-1H-pteridine-2,4,7-trione |
| SMILES | CC1NC2C(=O)NC(=O)NC2N(C)C1=O |
| InChI | InChI=1S/C8H12N4O3/c1-3-7(14)12(2)5-4(9-3)6(13)11-8(15)10-5/h3-5,9H,1-2H3,(H2,10,11,13,15) |
| InChIKey | PFKROSDJRRVXKQ-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |