C23H34O3 — CID 74051197
2,4-dimethoxy-6-[3-methyl-5-(1,2,6-trimethylcyclohex-2-en-1-yl)pent-2-enyl]phenol (PubChem CID 74051197) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2,4-dimethoxy-6-[3-methyl-5-(1,2,6-trimethylcyclohex-2-en-1-yl)pent-2-enyl]phenol.
| Compound Name | 2,4-dimethoxy-6-[3-methyl-5-(1,2,6-trimethylcyclohex-2-en-1-yl)pent-2-enyl]phenol |
|---|---|
| PubChem CID | 74051197 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2,4-dimethoxy-6-[3-methyl-5-(1,2,6-trimethylcyclohex-2-en-1-yl)pent-2-enyl]phenol |
| SMILES | COc1cc(CC=C(C)CCC2(C)C(C)=CCCC2C)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H34O3/c1-16(12-13-23(4)17(2)8-7-9-18(23)3)10-11-19-14-20(25-5)15-21(26-6)22(19)24/h8,10,14-15,18,24H,7,9,11-13H2,1-6H3 |
| InChIKey | WFPNAXCDJWECFJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|