About 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide
2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (PubChem CID 74051425) has the molecular formula C8H8BrNO3
and a molecular weight of 246.06 g/mol. Its IUPAC name is 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide |
| PubChem CID | 74051425 |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.06 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide |
| SMILES | NC(=O)CC1(O)C=CC(=O)C(Br)=C1 |
| InChI | InChI=1S/C8H8BrNO3/c9-5-3-8(13,4-7(10)12)2-1-6(5)11/h1-3,13H,4H2,(H2,10,12) |
| InChIKey | IKAYLXNAYBFVMC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.06 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The IUPAC name of 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (CID 74051425) is 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide.
What is the SMILES notation for 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The canonical SMILES for 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide is NC(=O)CC1(O)C=CC(=O)C(Br)=C1.
What is the InChIKey of 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The InChIKey is IKAYLXNAYBFVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO3/c9-5-3-8(13,4-7(10)12)2-1-6(5)11/h1-3,13H,4H2,(H2,10,12).
What are the key properties of 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide has a molecular weight of 246.06 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide is sourced from PubChem (CID 74051425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).