C22H26O4 — CID 74051854
3-ethyl-7-hydroxy-2,22-dioxabicyclo[16.3.1]docosa-1(21),3,5,9,18-pentaen-12-yn-20-one (PubChem CID 74051854) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-ethyl-7-hydroxy-2,22-dioxabicyclo[16.3.1]docosa-1(21),3,5,9,18-pentaen-12-yn-20-one.
| Compound Name | 3-ethyl-7-hydroxy-2,22-dioxabicyclo[16.3.1]docosa-1(21),3,5,9,18-pentaen-12-yn-20-one |
|---|---|
| PubChem CID | 74051854 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-ethyl-7-hydroxy-2,22-dioxabicyclo[16.3.1]docosa-1(21),3,5,9,18-pentaen-12-yn-20-one |
| SMILES | CCC1=CC=CC(O)CC=CCC#CCCCCc2cc(=O)cc(o2)O1 |
| InChI | InChI=1S/C22H26O4/c1-2-20-15-11-13-18(23)12-9-7-5-3-4-6-8-10-14-21-16-19(24)17-22(25-20)26-21/h7,9,11,13,15-18,23H,2,5-6,8,10,12,14H2,1H3 |
| InChIKey | XZVSUPMXFGXKHL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|