About 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one
14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one (PubChem CID 74051998) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one.
Molecular Properties
| Compound Name | 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one |
| PubChem CID | 74051998 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one |
| SMILES | CC(=CCCC(C)O)CCCC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C18H34O2/c1-14(2)12-18(20)13-16(4)10-6-8-15(3)9-7-11-17(5)19/h9,14,16-17,19H,6-8,10-13H2,1-5H3 |
| InChIKey | GDRMRPKWVXLGBG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one?
The IUPAC name of 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one (CID 74051998) is 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one.
What is the SMILES notation for 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one?
The canonical SMILES for 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one is CC(=CCCC(C)O)CCCC(C)CC(=O)CC(C)C.
What is the InChIKey of 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one?
The InChIKey is GDRMRPKWVXLGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-14(2)12-18(20)13-16(4)10-6-8-15(3)9-7-11-17(5)19/h9,14,16-17,19H,6-8,10-13H2,1-5H3.
What are the key properties of 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one?
14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one has a molecular weight of 282.47 g/mol, XLogP of 4.91, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one is sourced from PubChem (CID 74051998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).