C20H30O3 — CID 74052238
1,5,12-trimethyl-9-propan-2-ylidene-6,14,15-trioxatricyclo[11.2.2.05,7]heptadeca-2,11-diene (PubChem CID 74052238) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1,5,12-trimethyl-9-propan-2-ylidene-6,14,15-trioxatricyclo[11.2.2.05,7]heptadeca-2,11-diene.
| Compound Name | 1,5,12-trimethyl-9-propan-2-ylidene-6,14,15-trioxatricyclo[11.2.2.05,7]heptadeca-2,11-diene |
|---|---|
| PubChem CID | 74052238 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1,5,12-trimethyl-9-propan-2-ylidene-6,14,15-trioxatricyclo[11.2.2.05,7]heptadeca-2,11-diene |
| SMILES | CC1=CCC(=C(C)C)CC2OC2(C)CC=CC2(C)CCC1OO2 |
| InChI | InChI=1S/C20H30O3/c1-14(2)16-8-7-15(3)17-9-12-19(4,23-22-17)10-6-11-20(5)18(13-16)21-20/h6-7,10,17-18H,8-9,11-13H2,1-5H3 |
| InChIKey | UELHJSFKTYFPFX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|