C17H26O4 — CID 74052278
(2,8-dihydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl) acetate (PubChem CID 74052278) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2,8-dihydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl) acetate.
| Compound Name | (2,8-dihydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl) acetate |
|---|---|
| PubChem CID | 74052278 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2,8-dihydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl) acetate |
| SMILES | CC(=O)OC1C(C)=CC2(C)C(=CC(O)CC2C)CCC1O |
| InChI | InChI=1S/C17H26O4/c1-10-9-17(4)11(2)7-14(19)8-13(17)5-6-15(20)16(10)21-12(3)18/h8-9,11,14-16,19-20H,5-7H2,1-4H3 |
| InChIKey | YXIHIUFDGHGIME-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|