C41H52O2 — CID 74052315
6-methoxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,3,4-trimethylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-one (PubChem CID 74052315) has the molecular formula C41H52O2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 6-methoxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,3,4-trimethylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-one.
| Compound Name | 6-methoxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,3,4-trimethylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 74052315 |
| Molecular Formula | C41H52O2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | 6-methoxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,3,4-trimethylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-one |
| SMILES | COC1CC(C)(C)C(C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=Cc2ccc(C)c(C)c2C)=C(C)C1=O |
| InChI | InChI=1S/C41H52O2/c1-29(18-14-20-31(3)22-25-37-26-24-33(5)34(6)35(37)7)16-12-13-17-30(2)19-15-21-32(4)23-27-38-36(8)40(42)39(43-11)28-41(38,9)10/h12-27,39H,28H2,1-11H3 |
| InChIKey | OOXBHKYLJNCZTD-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|