About 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine
2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine (PubChem CID 74053003) has the molecular formula C16H22FNO
and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine |
| PubChem CID | 74053003 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine |
| SMILES | CC=CCCc1ccc(C2NC(C)(C)CO2)c(F)c1 |
| InChI | InChI=1S/C16H22FNO/c1-4-5-6-7-12-8-9-13(14(17)10-12)15-18-16(2,3)11-19-15/h4-5,8-10,15,18H,6-7,11H2,1-3H3 |
| InChIKey | ZAANVAOJSCJFAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine?
The IUPAC name of 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine (CID 74053003) is 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine.
What is the SMILES notation for 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine?
The canonical SMILES for 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine is CC=CCCc1ccc(C2NC(C)(C)CO2)c(F)c1.
What is the InChIKey of 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine?
The InChIKey is ZAANVAOJSCJFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO/c1-4-5-6-7-12-8-9-13(14(17)10-12)15-18-16(2,3)11-19-15/h4-5,8-10,15,18H,6-7,11H2,1-3H3.
What are the key properties of 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine?
2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine has a molecular weight of 263.36 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-4-pent-3-enylphenyl)-4,4-dimethyl-1,3-oxazolidine is sourced from PubChem (CID 74053003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).