C23H24N2O3 — CID 7405591
4-[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-benzylbenzamide (PubChem CID 7405591) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-benzylbenzamide.
| Compound Name | 4-[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 7405591 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-benzylbenzamide |
| SMILES | C[C@@H]1CC[C@@H]2C(=O)N(c3ccc(C(=O)NCc4ccccc4)cc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H24N2O3/c1-15-7-12-19-20(13-15)23(28)25(22(19)27)18-10-8-17(9-11-18)21(26)24-14-16-5-3-2-4-6-16/h2-6,8-11,15,19-20H,7,12-14H2,1H3,(H,24,26)/t15-,19+,20-/m1/s1 |
| InChIKey | RRAKKZCDPCWSJE-UIAACRFSSA-N |
| XLogP | 3.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|