C56H47BF4O2 — CID 74057221
8-[[3-[(2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene)methyl]-2-phenylcyclohex-2-en-1-ylidene]methyl]-2,4-diphenyl-6,7-dihydro-5H-chromene tetrafluoroborate (PubChem CID 74057221) has the molecular formula C56H47BF4O2 and a molecular weight of 838.79 g/mol. Its IUPAC name is 8-[[3-[(2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene)methyl]-2-phenylcyclohex-2-en-1-ylidene]methyl]-2,4-diphenyl-6,7-dihydro-5H-chromene tetrafluoroborate.
| Compound Name | 8-[[3-[(2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene)methyl]-2-phenylcyclohex-2-en-1-ylidene]methyl]-2,4-diphenyl-6,7-dihydro-5H-chromene tetrafluoroborate |
|---|---|
| PubChem CID | 74057221 |
| Molecular Formula | C56H47BF4O2 |
| Molecular Weight | 838.79 g/mol |
| Exact Mass | 838.36 |
| IUPAC Name | 8-[[3-[(2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene)methyl]-2-phenylcyclohex-2-en-1-ylidene]methyl]-2,4-diphenyl-6,7-dihydro-5H-chromene tetrafluoroborate |
| SMILES | C(=C1CCCC(C=C2CCCc3c(-c4ccccc4)cc(-c4ccccc4)[o+]c32)=C1c1ccccc1)C1=C2OC(c3ccccc3)=CC(c3ccccc3)=C2CCC1.F[B-](F)(F)F |
| InChI | InChI=1S/C56H47O2.BF4/c1-6-19-39(20-7-1)50-37-52(41-23-10-3-11-24-41)57-55-46(31-17-33-48(50)55)35-44-29-16-30-45(54(44)43-27-14-5-15-28-43)36-47-32-18-34-49-51(40-21-8-2-9-22-40)38-53(58-56(47)49)42-25-12-4-13-26-42;2-1(3,4)5/h1-15,19-28,35-38H,16-18,29-34H2;/q+1;-1 |
| InChIKey | HCPOWBINQLPJHJ-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.79 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|