C9H14N4O4 — CID 74057503
1,3-diazinane-2,4-dione;5-methyl-1,3-diazinane-2,4-dione (PubChem CID 74057503) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 1,3-diazinane-2,4-dione;5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1,3-diazinane-2,4-dione;5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 74057503 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1,3-diazinane-2,4-dione;5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1CNC(=O)NC1=O.O=C1CCNC(=O)N1 |
| InChI | InChI=1S/C5H8N2O2.C4H6N2O2/c1-3-2-6-5(9)7-4(3)8;7-3-1-2-5-4(8)6-3/h3H,2H2,1H3,(H2,6,7,8,9);1-2H2,(H2,5,6,7,8) |
| InChIKey | QBNHOARLOLUQDM-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |