About 1,10-phenanthroline-2,9-dione
1,10-phenanthroline-2,9-dione (PubChem CID 74057504) has the molecular formula C12H6N2O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is 1,10-phenanthroline-2,9-dione.
Molecular Properties
| Compound Name | 1,10-phenanthroline-2,9-dione |
| PubChem CID | 74057504 |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 1,10-phenanthroline-2,9-dione |
| SMILES | O=C1C=Cc2ccc3c(c2=N1)=NC(=O)C=C3 |
| InChI | InChI=1S/C12H6N2O2/c15-9-5-3-7-1-2-8-4-6-10(16)14-12(8)11(7)13-9/h1-6H |
| InChIKey | LIUDFYJJOKMFET-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,10-phenanthroline-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-phenanthroline-2,9-dione?
The IUPAC name of 1,10-phenanthroline-2,9-dione (CID 74057504) is 1,10-phenanthroline-2,9-dione.
What is the SMILES notation for 1,10-phenanthroline-2,9-dione?
The canonical SMILES for 1,10-phenanthroline-2,9-dione is O=C1C=Cc2ccc3c(c2=N1)=NC(=O)C=C3.
What is the InChIKey of 1,10-phenanthroline-2,9-dione?
The InChIKey is LIUDFYJJOKMFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2O2/c15-9-5-3-7-1-2-8-4-6-10(16)14-12(8)11(7)13-9/h1-6H.
What are the key properties of 1,10-phenanthroline-2,9-dione?
1,10-phenanthroline-2,9-dione has a molecular weight of 210.19 g/mol, XLogP of 0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-phenanthroline-2,9-dione is sourced from PubChem (CID 74057504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).