C20H31F5 — CID 74060331
1-(1,2,3,3,3-pentafluoroprop-1-enyl)-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 74060331) has the molecular formula C20H31F5 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(1,2,3,3,3-pentafluoroprop-1-enyl)-4-(4-pentylcyclohexyl)cyclohexane.
| Compound Name | 1-(1,2,3,3,3-pentafluoroprop-1-enyl)-4-(4-pentylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 74060331 |
| Molecular Formula | C20H31F5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-(1,2,3,3,3-pentafluoroprop-1-enyl)-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | CCCCCC1CCC(C2CCC(C(F)=C(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C20H31F5/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(21)19(22)20(23,24)25/h14-17H,2-13H2,1H3 |
| InChIKey | VHVHZTWAIIYISD-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|