C22H25N5S — CID 7406402
7-[4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazin-1-yl]-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine (PubChem CID 7406402) has the molecular formula C22H25N5S and a molecular weight of 391.54 g/mol. Its IUPAC name is 7-[4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazin-1-yl]-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine.
| Compound Name | 7-[4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazin-1-yl]-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 7406402 |
| Molecular Formula | C22H25N5S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 7-[4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazin-1-yl]-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine |
| SMILES | C1=CC[C@@H](CN2CCN(c3ncnc4c(-c5ccccc5)nsc34)CC2)CC1 |
| InChI | InChI=1S/C22H25N5S/c1-3-7-17(8-4-1)15-26-11-13-27(14-12-26)22-21-20(23-16-24-22)19(25-28-21)18-9-5-2-6-10-18/h1-3,5-6,9-10,16-17H,4,7-8,11-15H2/t17-/m1/s1 |
| InChIKey | AEPVWDFNQYVAOI-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|