C24H31ClN4O — CID 74069348
(2-chlorophenyl)-(2-propylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone (PubChem CID 74069348) has the molecular formula C24H31ClN4O and a molecular weight of 426.99 g/mol. Its IUPAC name is (2-chlorophenyl)-(2-propylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone.
| Compound Name | (2-chlorophenyl)-(2-propylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone |
|---|---|
| PubChem CID | 74069348 |
| Molecular Formula | C24H31ClN4O |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2-chlorophenyl)-(2-propylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone |
| SMILES | CCCc1nc2n(n1)C1(CCCCC1)C1CCCCC1N2C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H31ClN4O/c1-2-10-21-26-23-28(22(30)17-11-4-6-13-19(17)25)20-14-7-5-12-18(20)24(29(23)27-21)15-8-3-9-16-24/h4,6,11,13,18,20H,2-3,5,7-10,12,14-16H2,1H3 |
| InChIKey | IEOCWUYNKGTNJO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |