C28H38N4O2 — CID 74069375
(2-cyclohexylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-methoxyphenyl)methanone (PubChem CID 74069375) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (2-cyclohexylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (2-cyclohexylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 74069375 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (2-cyclohexylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2c3nc(C4CCCCC4)nn3C3(CCCCC3)C3CCCCC32)c1 |
| InChI | InChI=1S/C28H38N4O2/c1-34-22-14-10-13-21(19-22)26(33)31-24-16-7-6-15-23(24)28(17-8-3-9-18-28)32-27(31)29-25(30-32)20-11-4-2-5-12-20/h10,13-14,19-20,23-24H,2-9,11-12,15-18H2,1H3 |
| InChIKey | WFZSBBUTVHXFRU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |