About 3,7-dimethyloct-6-en-1-ol;hydrate
3,7-dimethyloct-6-en-1-ol;hydrate (PubChem CID 74069754) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is 3,7-dimethyloct-6-en-1-ol;hydrate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-en-1-ol;hydrate |
| PubChem CID | 74069754 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 3,7-dimethyloct-6-en-1-ol;hydrate |
| SMILES | CC(C)=CCCC(C)CCO.O |
| InChI | InChI=1S/C10H20O.H2O/c1-9(2)5-4-6-10(3)7-8-11;/h5,10-11H,4,6-8H2,1-3H3;1H2 |
| InChIKey | ZTCSAUQQZDQMKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-en-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-en-1-ol;hydrate?
The IUPAC name of 3,7-dimethyloct-6-en-1-ol;hydrate (CID 74069754) is 3,7-dimethyloct-6-en-1-ol;hydrate.
What is the SMILES notation for 3,7-dimethyloct-6-en-1-ol;hydrate?
The canonical SMILES for 3,7-dimethyloct-6-en-1-ol;hydrate is CC(C)=CCCC(C)CCO.O.
What is the InChIKey of 3,7-dimethyloct-6-en-1-ol;hydrate?
The InChIKey is ZTCSAUQQZDQMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.H2O/c1-9(2)5-4-6-10(3)7-8-11;/h5,10-11H,4,6-8H2,1-3H3;1H2.
What are the key properties of 3,7-dimethyloct-6-en-1-ol;hydrate?
3,7-dimethyloct-6-en-1-ol;hydrate has a molecular weight of 174.28 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-en-1-ol;hydrate is sourced from PubChem (CID 74069754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).